C14H12N2O3 — CID 136894397
(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-cyclopropyl-1H-imidazol-5-one (PubChem CID 136894397) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-cyclopropyl-1H-imidazol-5-one.
| Compound Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-cyclopropyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894397 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-cyclopropyl-1H-imidazol-5-one |
| SMILES | O=C1NC(C2CC2)=N/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O3/c17-14-10(15-13(16-14)9-2-3-9)5-8-1-4-11-12(6-8)19-7-18-11/h1,4-6,9H,2-3,7H2,(H,15,16,17)/b10-5+ |
| InChIKey | ZIIUMCZAESIUJP-BJMVGYQFSA-N |
| XLogP | 1.69 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|