C14H13BrN2O — CID 136894648
(4E)-4-[(3-bromophenyl)methylidene]-2-cyclobutyl-1H-imidazol-5-one (PubChem CID 136894648) has the molecular formula C14H13BrN2O and a molecular weight of 305.18 g/mol. Its IUPAC name is (4E)-4-[(3-bromophenyl)methylidene]-2-cyclobutyl-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3-bromophenyl)methylidene]-2-cyclobutyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894648 |
| Molecular Formula | C14H13BrN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (4E)-4-[(3-bromophenyl)methylidene]-2-cyclobutyl-1H-imidazol-5-one |
| SMILES | O=C1NC(C2CCC2)=N/C1=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O/c15-11-6-1-3-9(7-11)8-12-14(18)17-13(16-12)10-4-2-5-10/h1,3,6-8,10H,2,4-5H2,(H,16,17,18)/b12-8+ |
| InChIKey | DRSSAMKAWZZJOX-XYOKQWHBSA-N |
| XLogP | 3.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|