C16H10BrFN2O — CID 136894615
(4E)-4-[(3-bromophenyl)methylidene]-2-(3-fluorophenyl)-1H-imidazol-5-one (PubChem CID 136894615) has the molecular formula C16H10BrFN2O and a molecular weight of 345.17 g/mol. Its IUPAC name is (4E)-4-[(3-bromophenyl)methylidene]-2-(3-fluorophenyl)-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3-bromophenyl)methylidene]-2-(3-fluorophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894615 |
| Molecular Formula | C16H10BrFN2O |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (4E)-4-[(3-bromophenyl)methylidene]-2-(3-fluorophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2cccc(F)c2)=N/C1=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C16H10BrFN2O/c17-12-5-1-3-10(7-12)8-14-16(21)20-15(19-14)11-4-2-6-13(18)9-11/h1-9H,(H,19,20,21)/b14-8+ |
| InChIKey | ZUOYLWUUCNLKFO-RIYZIHGNSA-N |
| XLogP | 3.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|