C16H9BrF2N2O — CID 136894651
(4E)-4-[(3-bromophenyl)methylidene]-2-(3,4-difluorophenyl)-1H-imidazol-5-one (PubChem CID 136894651) has the molecular formula C16H9BrF2N2O and a molecular weight of 363.16 g/mol. Its IUPAC name is (4E)-4-[(3-bromophenyl)methylidene]-2-(3,4-difluorophenyl)-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3-bromophenyl)methylidene]-2-(3,4-difluorophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894651 |
| Molecular Formula | C16H9BrF2N2O |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | (4E)-4-[(3-bromophenyl)methylidene]-2-(3,4-difluorophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(F)c(F)c2)=N/C1=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C16H9BrF2N2O/c17-11-3-1-2-9(6-11)7-14-16(22)21-15(20-14)10-4-5-12(18)13(19)8-10/h1-8H,(H,20,21,22)/b14-7+ |
| InChIKey | TYSQBWBMGBABPH-VGOFMYFVSA-N |
| XLogP | 3.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|