C28H19FN2O2 — CID 176914429
(4Z)-2-[4-(3-fluorophenyl)phenyl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 176914429) has the molecular formula C28H19FN2O2 and a molecular weight of 434.47 g/mol. Its IUPAC name is (4Z)-2-[4-(3-fluorophenyl)phenyl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4Z)-2-[4-(3-fluorophenyl)phenyl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 176914429 |
| Molecular Formula | C28H19FN2O2 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (4Z)-2-[4-(3-fluorophenyl)phenyl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(-c3cccc(F)c3)cc2)=N/C1=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H19FN2O2/c29-23-8-5-7-22(18-23)20-12-14-21(15-13-20)27-30-26(28(32)31-27)17-19-6-4-11-25(16-19)33-24-9-2-1-3-10-24/h1-18H,(H,30,31,32)/b26-17- |
| InChIKey | AIQYBMDNWFLGGM-ONUIUJJFSA-N |
| XLogP | 6.20 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|