C17H13ClN2O2 — CID 136895149
(4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2-phenyl-1H-imidazol-5-one (PubChem CID 136895149) has the molecular formula C17H13ClN2O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2-phenyl-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2-phenyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895149 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2-phenyl-1H-imidazol-5-one |
| SMILES | COc1ccc(/C=C2/N=C(c3ccccc3)NC2=O)cc1Cl |
| InChI | InChI=1S/C17H13ClN2O2/c1-22-15-8-7-11(9-13(15)18)10-14-17(21)20-16(19-14)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,20,21)/b14-10+ |
| InChIKey | GULLCLXPGXCLAO-GXDHUFHOSA-N |
| XLogP | 3.27 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|