C19H18N2O4 — CID 136893798
(4E)-2-(2,6-dimethoxyphenyl)-4-[(3-methoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136893798) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (4E)-2-(2,6-dimethoxyphenyl)-4-[(3-methoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-(2,6-dimethoxyphenyl)-4-[(3-methoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893798 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (4E)-2-(2,6-dimethoxyphenyl)-4-[(3-methoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1cccc(/C=C2/N=C(c3c(OC)cccc3OC)NC2=O)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-23-13-7-4-6-12(10-13)11-14-19(22)21-18(20-14)17-15(24-2)8-5-9-16(17)25-3/h4-11H,1-3H3,(H,20,21,22)/b14-11+ |
| InChIKey | OVEAICSRXRADEV-SDNWHVSQSA-N |
| XLogP | 2.63 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|