C17H15N3O3 — CID 136893263
(4E)-2-(2,6-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136893263) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is (4E)-2-(2,6-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | (4E)-2-(2,6-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136893263 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4E)-2-(2,6-dimethoxyphenyl)-4-(pyridin-3-ylmethylidene)-1H-imidazol-5-one |
| SMILES | COc1cccc(OC)c1C1=N/C(=C/c2cccnc2)C(=O)N1 |
| InChI | InChI=1S/C17H15N3O3/c1-22-13-6-3-7-14(23-2)15(13)16-19-12(17(21)20-16)9-11-5-4-8-18-10-11/h3-10H,1-2H3,(H,19,20,21)/b12-9+ |
| InChIKey | YAFMJSBSUXRLMV-FMIVXFBMSA-N |
| XLogP | 2.02 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|