C19H17FN2O4 — CID 136895374
(4E)-2-(2,6-dimethoxyphenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136895374) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is (4E)-2-(2,6-dimethoxyphenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-(2,6-dimethoxyphenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895374 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (4E)-2-(2,6-dimethoxyphenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1ccc(F)cc1/C=C1/N=C(c2c(OC)cccc2OC)NC1=O |
| InChI | InChI=1S/C19H17FN2O4/c1-24-14-8-7-12(20)9-11(14)10-13-19(23)22-18(21-13)17-15(25-2)5-4-6-16(17)26-3/h4-10H,1-3H3,(H,21,22,23)/b13-10+ |
| InChIKey | UPFKFPNYCHPQJA-JLHYYAGUSA-N |
| XLogP | 2.77 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|