C17H11F3N2O2 — CID 136895400
(4E)-2-(3,4-difluorophenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136895400) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is (4E)-2-(3,4-difluorophenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-(3,4-difluorophenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895400 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (4E)-2-(3,4-difluorophenyl)-4-[(5-fluoro-2-methoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1ccc(F)cc1/C=C1/N=C(c2ccc(F)c(F)c2)NC1=O |
| InChI | InChI=1S/C17H11F3N2O2/c1-24-15-5-3-11(18)6-10(15)8-14-17(23)22-16(21-14)9-2-4-12(19)13(20)7-9/h2-8H,1H3,(H,21,22,23)/b14-8+ |
| InChIKey | SCORIIANRKBXST-RIYZIHGNSA-N |
| XLogP | 3.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|