C26H17FN2O2S — CID 176914438
(4Z)-2-[5-(3-fluorophenyl)thiophen-2-yl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 176914438) has the molecular formula C26H17FN2O2S and a molecular weight of 440.50 g/mol. Its IUPAC name is (4Z)-2-[5-(3-fluorophenyl)thiophen-2-yl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4Z)-2-[5-(3-fluorophenyl)thiophen-2-yl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 176914438 |
| Molecular Formula | C26H17FN2O2S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (4Z)-2-[5-(3-fluorophenyl)thiophen-2-yl]-4-[(3-phenoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(-c3cccc(F)c3)s2)=N/C1=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H17FN2O2S/c27-19-8-5-7-18(16-19)23-12-13-24(32-23)25-28-22(26(30)29-25)15-17-6-4-11-21(14-17)31-20-9-2-1-3-10-20/h1-16H,(H,28,29,30)/b22-15- |
| InChIKey | ZSCRQNWFJJKAAE-JCMHNJIXSA-N |
| XLogP | 6.26 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|