C16H9BrClN3O3 — CID 135699340
(4Z)-4-[(4-bromophenyl)methylidene]-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one (PubChem CID 135699340) has the molecular formula C16H9BrClN3O3 and a molecular weight of 406.62 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135699340 |
| Molecular Formula | C16H9BrClN3O3 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(Cl)c([N+](=O)[O-])c2)=N/C1=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H9BrClN3O3/c17-11-4-1-9(2-5-11)7-13-16(22)20-15(19-13)10-3-6-12(18)14(8-10)21(23)24/h1-8H,(H,19,20,22)/b13-7- |
| InChIKey | ZVFPSSGBGGKWTE-QPEQYQDCSA-N |
| XLogP | 3.93 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|