C16H10Br2N2O — CID 135500373
2-(4-bromophenyl)-4-[(4-bromophenyl)methylidene]-1H-imidazol-5-one (PubChem CID 135500373) has the molecular formula C16H10Br2N2O and a molecular weight of 406.08 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(4-bromophenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | 2-(4-bromophenyl)-4-[(4-bromophenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135500373 |
| Molecular Formula | C16H10Br2N2O |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(4-bromophenyl)methylidene]-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(Br)cc2)=NC1=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H10Br2N2O/c17-12-5-1-10(2-6-12)9-14-16(21)20-15(19-14)11-3-7-13(18)8-4-11/h1-9H,(H,19,20,21) |
| InChIKey | JCYYTKNHNXNHRD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|