C20H20BrN3O — CID 135504837
2-(4-bromophenyl)-4-[[4-(diethylamino)phenyl]methylidene]-1H-imidazol-5-one (PubChem CID 135504837) has the molecular formula C20H20BrN3O and a molecular weight of 398.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[[4-(diethylamino)phenyl]methylidene]-1H-imidazol-5-one.
| Compound Name | 2-(4-bromophenyl)-4-[[4-(diethylamino)phenyl]methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135504837 |
| Molecular Formula | C20H20BrN3O |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(4-bromophenyl)-4-[[4-(diethylamino)phenyl]methylidene]-1H-imidazol-5-one |
| SMILES | CCN(CC)c1ccc(C=C2N=C(c3ccc(Br)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H20BrN3O/c1-3-24(4-2)17-11-5-14(6-12-17)13-18-20(25)23-19(22-18)15-7-9-16(21)10-8-15/h5-13H,3-4H2,1-2H3,(H,22,23,25) |
| InChIKey | XEFVANLRIXXVHW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|