C16H10ClN3O3 — CID 135699336
(4Z)-4-benzylidene-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one (PubChem CID 135699336) has the molecular formula C16H10ClN3O3 and a molecular weight of 327.73 g/mol. Its IUPAC name is (4Z)-4-benzylidene-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one.
| Compound Name | (4Z)-4-benzylidene-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135699336 |
| Molecular Formula | C16H10ClN3O3 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (4Z)-4-benzylidene-2-(4-chloro-3-nitrophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccc(Cl)c([N+](=O)[O-])c2)=N/C1=C\c1ccccc1 |
| InChI | InChI=1S/C16H10ClN3O3/c17-12-7-6-11(9-14(12)20(22)23)15-18-13(16(21)19-15)8-10-4-2-1-3-5-10/h1-9H,(H,18,19,21)/b13-8- |
| InChIKey | GCBUKMDODDCWTO-JYRVWZFOSA-N |
| XLogP | 3.17 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|