About (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one
(4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136895662) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one.
Molecular Properties
| Compound Name | (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one |
| PubChem CID | 136895662 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | Cc1cc(C)c(/C=C2\N=C(C3CCC3)NC2=O)c(C)c1 |
| InChI | InChI=1S/C17H20N2O/c1-10-7-11(2)14(12(3)8-10)9-15-17(20)19-16(18-15)13-5-4-6-13/h7-9,13H,4-6H2,1-3H3,(H,18,19,20)/b15-9- |
| InChIKey | KHROMXXZSUEPKH-DHDCSXOGSA-N |
| XLogP | 3.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one?
The IUPAC name of (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one (CID 136895662) is (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one.
What is the SMILES notation for (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one?
The canonical SMILES for (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one is Cc1cc(C)c(/C=C2\N=C(C3CCC3)NC2=O)c(C)c1.
What is the InChIKey of (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one?
The InChIKey is KHROMXXZSUEPKH-DHDCSXOGSA-N. The full InChI is InChI=1S/C17H20N2O/c1-10-7-11(2)14(12(3)8-10)9-15-17(20)19-16(18-15)13-5-4-6-13/h7-9,13H,4-6H2,1-3H3,(H,18,19,20)/b15-9-.
What are the key properties of (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one?
(4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one has a molecular weight of 268.36 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-cyclobutyl-4-[(2,4,6-trimethylphenyl)methylidene]-1H-imidazol-5-one is sourced from PubChem (CID 136895662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).