C17H20N2O4 — CID 136894594
(4E)-2-cyclobutyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136894594) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (4E)-2-cyclobutyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-cyclobutyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894594 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (4E)-2-cyclobutyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(C3CCC3)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O4/c1-21-13-8-10(9-14(22-2)15(13)23-3)7-12-17(20)19-16(18-12)11-5-4-6-11/h7-9,11H,4-6H2,1-3H3,(H,18,19,20)/b12-7+ |
| InChIKey | XQBMETYPEKEMFM-KPKJPENVSA-N |
| XLogP | 2.38 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|