C15H14Cl2N2O2 — CID 136895344
(4E)-4-[(3,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1H-imidazol-5-one (PubChem CID 136895344) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.19 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895344 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1H-imidazol-5-one |
| SMILES | O=C1NC(C2CCOCC2)=N/C1=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-11-2-1-9(7-12(11)17)8-13-15(20)19-14(18-13)10-3-5-21-6-4-10/h1-2,7-8,10H,3-6H2,(H,18,19,20)/b13-8+ |
| InChIKey | JIRXIENIOPPXAH-MDWZMJQESA-N |
| XLogP | 3.29 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|