C17H9Cl2IN2O3 — CID 135478451
4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-5-iodophenyl)-1H-imidazol-5-one (PubChem CID 135478451) has the molecular formula C17H9Cl2IN2O3 and a molecular weight of 487.08 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-5-iodophenyl)-1H-imidazol-5-one.
| Compound Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-5-iodophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135478451 |
| Molecular Formula | C17H9Cl2IN2O3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 485.90 |
| IUPAC Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-5-iodophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2cc(I)ccc2Cl)=NC1=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H9Cl2IN2O3/c18-11-2-1-9(20)5-10(11)16-21-13(17(23)22-16)3-8-4-14-15(6-12(8)19)25-7-24-14/h1-6H,7H2,(H,21,22,23) |
| InChIKey | JEDRFGVFDHKAQE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|