C17H9ClO4 — CID 126397583
2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]indene-1,3-dione (PubChem CID 126397583) has the molecular formula C17H9ClO4 and a molecular weight of 312.71 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 126397583 |
| Molecular Formula | C17H9ClO4 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3c(cc2Cl)OCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H9ClO4/c18-13-7-15-14(21-8-22-15)6-9(13)5-12-16(19)10-3-1-2-4-11(10)17(12)20/h1-7H,8H2 |
| InChIKey | USNNMMAUBPGCDY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|