C19H13ClO4 — CID 9353065
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]indene-1,3-dione (PubChem CID 9353065) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 9353065 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc(Cl)c3c(c2)OCCCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H13ClO4/c20-15-9-11(10-16-19(15)24-7-3-6-23-16)8-14-17(21)12-4-1-2-5-13(12)18(14)22/h1-2,4-5,8-10H,3,6-7H2 |
| InChIKey | ZIDLAUAKEQZJAY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|