C10H9ClO2 — CID 64665956
5-chloro-7-ethenyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 64665956) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 5-chloro-7-ethenyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-chloro-7-ethenyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 64665956 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 5-chloro-7-ethenyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=Cc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C10H9ClO2/c1-2-7-5-8(11)10-9(6-7)12-3-4-13-10/h2,5-6H,1,3-4H2 |
| InChIKey | AJMCABJUDTVIBC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |