C9H9ClO2 — CID 20765776
5-chloro-7-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 20765776) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is 5-chloro-7-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-chloro-7-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 20765776 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 5-chloro-7-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C9H9ClO2/c1-6-4-7(10)9-8(5-6)11-2-3-12-9/h4-5H,2-3H2,1H3 |
| InChIKey | JTLCIYGBLNUNAE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |