C10H10BrClO — CID 130787930
4-bromo-8-chloro-6-methyl-3,4-dihydro-2H-chromene (PubChem CID 130787930) has the molecular formula C10H10BrClO and a molecular weight of 261.55 g/mol. Its IUPAC name is 4-bromo-8-chloro-6-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 4-bromo-8-chloro-6-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 130787930 |
| Molecular Formula | C10H10BrClO |
| Molecular Weight | 261.55 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 4-bromo-8-chloro-6-methyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc(Cl)c2c(c1)C(Br)CCO2 |
| InChI | InChI=1S/C10H10BrClO/c1-6-4-7-8(11)2-3-13-10(7)9(12)5-6/h4-5,8H,2-3H2,1H3 |
| InChIKey | WAVCVARYVTXPDF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|