C9H9FO2 — CID 20821264
7-fluoro-5-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 20821264) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 7-fluoro-5-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-fluoro-5-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 20821264 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 7-fluoro-5-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1cc(F)cc2c1OCCO2 |
| InChI | InChI=1S/C9H9FO2/c1-6-4-7(10)5-8-9(6)12-3-2-11-8/h4-5H,2-3H2,1H3 |
| InChIKey | UXRGZWKBQKBNTQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |