C11H11ClO3 — CID 65418218
1-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-ol (PubChem CID 65418218) has the molecular formula C11H11ClO3 and a molecular weight of 226.66 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-ol.
| Compound Name | 1-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 65418218 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C11H11ClO3/c1-2-9(13)7-5-8(12)11-10(6-7)14-3-4-15-11/h2,5-6,9,13H,1,3-4H2 |
| InChIKey | BTCQIQGGVQRZQU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|