C21H16ClNO6 — CID 9041682
3-[(4Z)-4-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid (PubChem CID 9041682) has the molecular formula C21H16ClNO6 and a molecular weight of 413.81 g/mol. Its IUPAC name is 3-[(4Z)-4-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid.
| Compound Name | 3-[(4Z)-4-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 9041682 |
| Molecular Formula | C21H16ClNO6 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-[(4Z)-4-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2cc(Cl)c3c(c2)OCCO3)c2ccccc2C1=O |
| InChI | InChI=1S/C21H16ClNO6/c22-16-10-12(11-17-19(16)29-8-7-28-17)9-15-13-3-1-2-4-14(13)20(26)23(21(15)27)6-5-18(24)25/h1-4,9-11H,5-8H2,(H,24,25)/b15-9- |
| InChIKey | XJMSBFJVQZJPTK-DHDCSXOGSA-N |
| XLogP | 3.11 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|