C17H16N2O7 — CID 3061003
3-[5-benzylidene-3-(2-carboxyethyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoic acid (PubChem CID 3061003) has the molecular formula C17H16N2O7 and a molecular weight of 360.32 g/mol. Its IUPAC name is 3-[5-benzylidene-3-(2-carboxyethyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoic acid.
| Compound Name | 3-[5-benzylidene-3-(2-carboxyethyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 3061003 |
| Molecular Formula | C17H16N2O7 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-[5-benzylidene-3-(2-carboxyethyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C(=Cc2ccccc2)C(=O)N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C17H16N2O7/c20-13(21)6-8-18-15(24)12(10-11-4-2-1-3-5-11)16(25)19(17(18)26)9-7-14(22)23/h1-5,10H,6-9H2,(H,20,21)(H,22,23) |
| InChIKey | XTWLTOOJDKGSRB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|