C20H15F2NO5 — CID 7503864
3-[(4Z)-4-[[4-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid (PubChem CID 7503864) has the molecular formula C20H15F2NO5 and a molecular weight of 387.34 g/mol. Its IUPAC name is 3-[(4Z)-4-[[4-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid.
| Compound Name | 3-[(4Z)-4-[[4-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 7503864 |
| Molecular Formula | C20H15F2NO5 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[(4Z)-4-[[4-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2ccc(OC(F)F)cc2)c2ccccc2C1=O |
| InChI | InChI=1S/C20H15F2NO5/c21-20(22)28-13-7-5-12(6-8-13)11-16-14-3-1-2-4-15(14)18(26)23(19(16)27)10-9-17(24)25/h1-8,11,20H,9-10H2,(H,24,25)/b16-11- |
| InChIKey | UGSQUYMBVOXSRF-WJDWOHSUSA-N |
| XLogP | 3.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|