C26H21F2NO5 — CID 2457319
(4E)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-[(4-methoxyphenyl)methyl]isoquinoline-1,3-dione (PubChem CID 2457319) has the molecular formula C26H21F2NO5 and a molecular weight of 465.45 g/mol. Its IUPAC name is (4E)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-[(4-methoxyphenyl)methyl]isoquinoline-1,3-dione.
| Compound Name | (4E)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-[(4-methoxyphenyl)methyl]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2457319 |
| Molecular Formula | C26H21F2NO5 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (4E)-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-[(4-methoxyphenyl)methyl]isoquinoline-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3ccc(OC(F)F)c(OC)c3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H21F2NO5/c1-32-18-10-7-16(8-11-18)15-29-24(30)20-6-4-3-5-19(20)21(25(29)31)13-17-9-12-22(34-26(27)28)23(14-17)33-2/h3-14,26H,15H2,1-2H3/b21-13+ |
| InChIKey | YPPVKABGKGMOIM-FYJGNVAPSA-N |
| XLogP | 5.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|