C20H15F2NO6 — CID 6250481
(1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 6250481) has the molecular formula C20H15F2NO6 and a molecular weight of 403.34 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6250481 |
| Molecular Formula | C20H15F2NO6 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCN2C(=O)c3ccccc3C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C20H15F2NO6/c1-27-16-10-12(6-8-15(16)29-20(21)22)7-9-17(24)28-11-23-18(25)13-4-2-3-5-14(13)19(23)26/h2-10,20H,11H2,1H3/b9-7+ |
| InChIKey | GYAXAXBQDVESFO-VQHVLOKHSA-N |
| XLogP | 3.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|