C24H20F2O4 — CID 7198966
benzhydryl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 7198966) has the molecular formula C24H20F2O4 and a molecular weight of 410.42 g/mol. Its IUPAC name is benzhydryl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | benzhydryl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7198966 |
| Molecular Formula | C24H20F2O4 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | benzhydryl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OC(c2ccccc2)c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C24H20F2O4/c1-28-21-16-17(12-14-20(21)29-24(25)26)13-15-22(27)30-23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16,23-24H,1H3/b15-13+ |
| InChIKey | WFUSXXAIEVQQDO-FYWRMAATSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|