About (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate
(6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 4237289) has the molecular formula C21H15BrF2O4
and a molecular weight of 449.25 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| PubChem CID | 4237289 |
| Molecular Formula | C21H15BrF2O4 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)Oc2ccc3cc(Br)ccc3c2)ccc1OC(F)F |
| InChI | InChI=1S/C21H15BrF2O4/c1-26-19-10-13(2-8-18(19)28-21(23)24)3-9-20(25)27-17-7-5-14-11-16(22)6-4-15(14)12-17/h2-12,21H,1H3 |
| InChIKey | WXACYESWJNMTLP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate?
The IUPAC name of (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (CID 4237289) is (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate?
The canonical SMILES for (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate is COc1cc(C=CC(=O)Oc2ccc3cc(Br)ccc3c2)ccc1OC(F)F.
What is the InChIKey of (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate?
The InChIKey is WXACYESWJNMTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrF2O4/c1-26-19-10-13(2-8-18(19)28-21(23)24)3-9-20(25)27-17-7-5-14-11-16(22)6-4-15(14)12-17/h2-12,21H,1H3.
What are the key properties of (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate?
(6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate has a molecular weight of 449.25 g/mol, XLogP of 5.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate is sourced from PubChem (CID 4237289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).