C25H19F2NO5S — CID 3343063
(2-oxo-2-phenothiazin-10-ylethyl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 3343063) has the molecular formula C25H19F2NO5S and a molecular weight of 483.49 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3343063 |
| Molecular Formula | C25H19F2NO5S |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)N2c3ccccc3Sc3ccccc32)ccc1OC(F)F |
| InChI | InChI=1S/C25H19F2NO5S/c1-31-20-14-16(10-12-19(20)33-25(26)27)11-13-24(30)32-15-23(29)28-17-6-2-4-8-21(17)34-22-9-5-3-7-18(22)28/h2-14,25H,15H2,1H3 |
| InChIKey | UKTBMRJKHNMHHX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|