C25H22N2O7 — CID 30431228
(1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 30431228) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 30431228 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCN2C(=O)c3ccccc3C2=O)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C25H22N2O7/c1-15-20(16(2)34-26-15)13-32-21-10-8-17(12-22(21)31-3)9-11-23(28)33-14-27-24(29)18-6-4-5-7-19(18)25(27)30/h4-12H,13-14H2,1-3H3/b11-9+ |
| InChIKey | FGUCDXBCWVCYDU-PKNBQFBNSA-N |
| XLogP | 3.69 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|