C23H22FNO5 — CID 7752735
(3-fluorophenyl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 7752735) has the molecular formula C23H22FNO5 and a molecular weight of 411.43 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (3-fluorophenyl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7752735 |
| Molecular Formula | C23H22FNO5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (3-fluorophenyl)methyl (E)-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2cccc(F)c2)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C23H22FNO5/c1-15-20(16(2)30-25-15)14-28-21-9-7-17(12-22(21)27-3)8-10-23(26)29-13-18-5-4-6-19(24)11-18/h4-12H,13-14H2,1-3H3/b10-8+ |
| InChIKey | AXOLIDLQGGQUBK-CSKARUKUSA-N |
| XLogP | 4.77 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|