C23H27NO5 — CID 76859705
cyclohex-3-en-1-ylmethyl 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 76859705) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | cyclohex-3-en-1-ylmethyl 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76859705 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC2CC=CCC2)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C23H27NO5/c1-16-20(17(2)29-24-16)15-27-21-11-9-18(13-22(21)26-3)10-12-23(25)28-14-19-7-5-4-6-8-19/h4-5,9-13,19H,6-8,14-15H2,1-3H3 |
| InChIKey | ALCFSIZYEXKTLS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|