C25H32N2O4 — CID 41041802
(E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 41041802) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 41041802 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (E)-1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC[C@@H]3CCCC[C@H]32)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C25H32N2O4/c1-17-21(18(2)31-26-17)16-30-23-12-10-19(15-24(23)29-3)11-13-25(28)27-14-6-8-20-7-4-5-9-22(20)27/h10-13,15,20,22H,4-9,14,16H2,1-3H3/b13-11+/t20-,22+/m0/s1 |
| InChIKey | DZXMYTQQCUBXMW-AZVDTTTQSA-N |
| XLogP | 5.07 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|