C19H12F2NO5- — CID 9367634
2-[(4Z)-4-[[2-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate (PubChem CID 9367634) has the molecular formula C19H12F2NO5- and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-[(4Z)-4-[[2-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[[2-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 9367634 |
| Molecular Formula | C19H12F2NO5- |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[(4Z)-4-[[2-(difluoromethoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)/C(=C\c2ccccc2OC(F)F)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13F2NO5/c20-19(21)27-15-8-4-1-5-11(15)9-14-12-6-2-3-7-13(12)17(25)22(18(14)26)10-16(23)24/h1-9,19H,10H2,(H,23,24)/p-1/b14-9- |
| InChIKey | SOUWMBHJJJKXFB-ZROIWOOFSA-M |
| XLogP | 1.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|