C18H10Cl2NO4- — CID 9367773
2-[(4Z)-4-[(2,6-dichlorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate (PubChem CID 9367773) has the molecular formula C18H10Cl2NO4- and a molecular weight of 375.19 g/mol. Its IUPAC name is 2-[(4Z)-4-[(2,6-dichlorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[(2,6-dichlorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 9367773 |
| Molecular Formula | C18H10Cl2NO4- |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-[(4Z)-4-[(2,6-dichlorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)/C(=C\c2c(Cl)cccc2Cl)c2ccccc2C1=O |
| InChI | InChI=1S/C18H11Cl2NO4/c19-14-6-3-7-15(20)13(14)8-12-10-4-1-2-5-11(10)17(24)21(18(12)25)9-16(22)23/h1-8H,9H2,(H,22,23)/p-1/b12-8- |
| InChIKey | KXSQJFDKSRMTDY-WQLSENKSSA-M |
| XLogP | 2.27 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|