C22H20NO4- — CID 8538518
3-[(4Z)-1,3-dioxo-4-[(4-propan-2-ylphenyl)methylidene]isoquinolin-2-yl]propanoate (PubChem CID 8538518) has the molecular formula C22H20NO4- and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-[(4Z)-1,3-dioxo-4-[(4-propan-2-ylphenyl)methylidene]isoquinolin-2-yl]propanoate.
| Compound Name | 3-[(4Z)-1,3-dioxo-4-[(4-propan-2-ylphenyl)methylidene]isoquinolin-2-yl]propanoate |
|---|---|
| PubChem CID | 8538518 |
| Molecular Formula | C22H20NO4- |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-[(4Z)-1,3-dioxo-4-[(4-propan-2-ylphenyl)methylidene]isoquinolin-2-yl]propanoate |
| SMILES | CC(C)c1ccc(/C=C2\C(=O)N(CCC(=O)[O-])C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H21NO4/c1-14(2)16-9-7-15(8-10-16)13-19-17-5-3-4-6-18(17)21(26)23(22(19)27)12-11-20(24)25/h3-10,13-14H,11-12H2,1-2H3,(H,24,25)/p-1/b19-13- |
| InChIKey | LMRWVWALEXPHSQ-UYRXBGFRSA-M |
| XLogP | 2.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|