C21H20ClNO4 — CID 7209289
2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209289) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209289 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)OCCN1C(=O)c2ccccc2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO4/c1-13(2)18(14-7-9-15(22)10-8-14)21(26)27-12-11-23-19(24)16-5-3-4-6-17(16)20(23)25/h3-10,13,18H,11-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | NJSDEBIPJDEQOB-SFHVURJKSA-N |
| XLogP | 3.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|