C25H23ClO3 — CID 7209368
[2-oxo-2-(4-phenylphenyl)ethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209368) has the molecular formula C25H23ClO3 and a molecular weight of 406.91 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209368 |
| Molecular Formula | C25H23ClO3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23ClO3/c1-17(2)24(21-12-14-22(26)15-13-21)25(28)29-16-23(27)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-15,17,24H,16H2,1-2H3/t24-/m1/s1 |
| InChIKey | VLHVSVBMQWPQIP-XMMPIXPASA-N |
| XLogP | 6.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |