About [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate
[2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate (PubChem CID 7228115) has the molecular formula C24H22O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate |
| PubChem CID | 7228115 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22O3/c1-18(19-8-4-2-5-9-19)16-24(26)27-17-23(25)22-14-12-21(13-15-22)20-10-6-3-7-11-20/h2-15,18H,16-17H2,1H3/t18-/m0/s1 |
| InChIKey | UIJJJRLUIFBOHG-SFHVURJKSA-N |
| XLogP | 5.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate?
The IUPAC name of [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate (CID 7228115) is [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate.
What is the SMILES notation for [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate?
The canonical SMILES for [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate is C[C@@H](CC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate?
The InChIKey is UIJJJRLUIFBOHG-SFHVURJKSA-N. The full InChI is InChI=1S/C24H22O3/c1-18(19-8-4-2-5-9-19)16-24(26)27-17-23(25)22-14-12-21(13-15-22)20-10-6-3-7-11-20/h2-15,18H,16-17H2,1H3/t18-/m0/s1.
What are the key properties of [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate?
[2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate has a molecular weight of 358.44 g/mol, XLogP of 5.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenylphenyl)ethyl] (3S)-3-phenylbutanoate is sourced from PubChem (CID 7228115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).