C21H23NO4 — CID 7783025
[2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 2-benzamidoacetate (PubChem CID 7783025) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7783025 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]phenyl]-2-oxoethyl] 2-benzamidoacetate |
| SMILES | CC[C@H](C)c1ccc(C(=O)COC(=O)CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-15(2)16-9-11-17(12-10-16)19(23)14-26-20(24)13-22-21(25)18-7-5-4-6-8-18/h4-12,15H,3,13-14H2,1-2H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | MLOJYWABBANCQI-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |