C19H20N2O6S — CID 7516811
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-benzamidoacetate (PubChem CID 7516811) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7516811 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-benzamidoacetate |
| SMILES | CN(c1ccc(C(=O)COC(=O)CNC(=O)c2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20N2O6S/c1-21(28(2,25)26)16-10-8-14(9-11-16)17(22)13-27-18(23)12-20-19(24)15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H,20,24) |
| InChIKey | XEWVEWVORNGWEA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |