C18H18FNO6S — CID 9458334
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 9458334) has the molecular formula C18H18FNO6S and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 9458334 |
| Molecular Formula | C18H18FNO6S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | CN(c1ccc(C(=O)COC(=O)COc2ccc(F)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H18FNO6S/c1-20(27(2,23)24)15-7-3-13(4-8-15)17(21)11-26-18(22)12-25-16-9-5-14(19)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | JSAMADWBTASALM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |