C14H22N2O4S — CID 30128546
N,N-diethyl-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide (PubChem CID 30128546) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N,N-diethyl-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 30128546 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N,N-diethyl-2-[4-[methyl(methylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-5-16(6-2)14(17)11-20-13-9-7-12(8-10-13)15(3)21(4,18)19/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | QLUFPOBSEWALDS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |