C23H20FNO6S — CID 2357304
phenacyl 2-[4-[(4-fluorophenyl)sulfonyl-methylamino]phenoxy]acetate (PubChem CID 2357304) has the molecular formula C23H20FNO6S and a molecular weight of 457.48 g/mol. Its IUPAC name is phenacyl 2-[4-[(4-fluorophenyl)sulfonyl-methylamino]phenoxy]acetate.
| Compound Name | phenacyl 2-[4-[(4-fluorophenyl)sulfonyl-methylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 2357304 |
| Molecular Formula | C23H20FNO6S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | phenacyl 2-[4-[(4-fluorophenyl)sulfonyl-methylamino]phenoxy]acetate |
| SMILES | CN(c1ccc(OCC(=O)OCC(=O)c2ccccc2)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO6S/c1-25(32(28,29)21-13-7-18(24)8-14-21)19-9-11-20(12-10-19)30-16-23(27)31-15-22(26)17-5-3-2-4-6-17/h2-14H,15-16H2,1H3 |
| InChIKey | UIIBSVVLQMOAHQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |