C15H18N2O6S2 — CID 7632587
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632587) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632587 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | CN(c1ccc(C(=O)COC(=O)CN2CCSC2=O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H18N2O6S2/c1-16(25(2,21)22)12-5-3-11(4-6-12)13(18)10-23-14(19)9-17-7-8-24-15(17)20/h3-6H,7-10H2,1-2H3 |
| InChIKey | LJPNITKCPFXEGJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|